1. Explain the terms 
              
                a) Drugs
                    b) Medicine 
                  c) Chemo therapy 
                   d) Target molecule 
                  e) Drug target
              
               2. How are drugs classified?
               3. How does enzyme act as drug target?
               4. Explain the following terms with respect to drug enzyme  interaction 
              
                a) enzyme inhibitor 
                  b) competitive  inhibitor
                  c) allosteric site.
              
               5. How do receptors act as drug target?
               6. Explain the following term with respect to respect to  receptor as drug target
              
                 a) antagonist 
                  b) agonist.
              
               7. What are antacids? Give two examples.
               8. Metal hydroxides are better antacids than hydrogen carbonates.  Why?
               9. Ranitidine and  cimitidine are better antacids than metal hydroxides and hydrogen carbonates. Why?
               10. Give two examples of antihistamine which are anti  allergic.
               11. While antacids and anti allergic drugs interfere with  the function of antihistamine, why they do not with  the  function of each other?
               12. What are tranquilisers? Give two examples.
               13. Why should not we take medicine with out consulting  doctor?
               14. Low level of noradrenaline is the cause for depression.  What type of drug is needed to cure this problem?  Name two such drugs. How do they react?
               15. Name two tranquilisers suitable for relieving tension.
               16. Name the tranquiliser used in controlling depression and  hyper tension.
               17. What are barbiturates? Give two examples.
               18. Which among the following are tranquilisers? Ranitidine,  valium, serotonin, and cimetidine.
               19. What are analgesics? How are they classified? Give two  examples each.
               20. How does aspirin act as analgesic?
               21. How does aspirin prevent heart attack?
               22. Why should we avoid using narcotics as analgesic?
               23. Morphine narcotics are referred as opiates. Why?
               24. Mention chief uses of narcotic analgesic.
               25. What are anti microbial drugs?
               26. What are antibiotics? Give two examples.
               27. What do you mean by bactericidal and bacteriostatic?  Give three examples each.
               28.  What are 
              
                a) broad  spectrum antibiotics
                  b) narrow spectrum antibiotics 
                     c) narrow spectrum antibiotics?  Give two examples each.
              
               29. Name the antibiotic developed by Paul Ehrlich for the  treatment of syphills.
               30. Name the antibiotic which leads to the discovery of  sulpha drugs.
               31. What are sulpha drugs? Give two examples.
               32. Name the antibiotic used to cure 
              
                a) typhoid
                     b)  tuberculosis.
              
               33. Classify the following as broad spectrum, narrow  spectrum or limited spectrum antibiotics:  Penicillin-G,  ampicillin,  amoxicillin, chloramphenicol, vancomycin and ofloxacin.
               34. Name the antibiotic which is toxic towards certain  strain of cancer cells.
               35. What are antiseptics? Give two examples.
               36. What are disinfectants? Give two examples.
               37. How do antiseptic differ from disinfectant?
               38. Name the substance which is used as antiseptic as well  as disinfectant.
               39. Mention the constituents of Dettol.
               40.  Name the  antiseptic added to soap.
               41. What is tincture of iodine?
               42. Classify the following as antiseptic or disinfectant: Furacin,  soframycin, tincture of iodine, iodoform, boric acid, 0.1% phenol, 1% phenol, 0.2 ppm, Cl2  and very low concentration of SO2.
               43. What are antifertility drugs? Give one example each of 
              
                a) synthetic progesterone
                   b) estrogen derivative  which are used as antifertility drug.
              
               44.  What are the main  categories of food additives?
               45.  Name the  artificial sweetening agent used by diabetic patient.
               46.  Why is aspartame  limited to cold food and drinks?
               47.  What problem  arises in using alitame as a sweetening agent?
               48.  Why do we need  artificial sweetening agent?
               49.  What is the  advantage of sucralose as a artificial sweetening agent?
               50.  What are food  preservatives? Give two examples.
               51.  What are soaps?  Give the equation of the reaction involved in the preparation of soap.
               52.  How is 
              
                a) Toilet  soap 
                  b) Transparent soap prepared?
              
               53.  Which chemical is  added to shaving soap to prevent rapid drying?
               54.  Name the gum  added to make shaving soap.
               55.  Name the  chemicals added to laundry soap.
               56.  Name the
              
                 a)  scouring agent 
                   b) builder added to soap. Mention the function of each.
              
               57.  Why does soap not  work in hard water?
               58.  What are detergents?  Mention the advantage and disadvantage of soap over detergent.
               59.  How are  detergents classified? Give one example each. Mention the use of each.
               60.  Write the  equation of the reaction involved in the preparation of 
              
                a) non ionic detergent 
                  b) anionic detergent.
              
               61.  What are  biodegradable and non biodegradable detergents? Give one example each.
               62. If water contain  calcium bicarbonate, out of soap and detergent which one will you use to clean clothes?      
63. Label the hydrophilic and hydrophobic part present in the following compounds:
      
         a) CH3(CH2)10CH2OSO3Na
         b) CH3(CH2)15 N(CH3)3Br
         c) CH3(CH2)10COO(CH2CH2O)nCH2 CH2OH
       
       d) C9H19 
 
         O(CH2CH2O)nCH2CH2OH
        
 
      
64. Give one important use of each of the following:
     
         i) terfenadine  
  
         ii) chlordiazepoxide   
         iii) Morphine  
         iv) dysidazirine 
         v) Norethindrone.